C16H15ClN2O — CID 43201943
3-(4-chloro-2-methylanilino)-5-methyl-1,3-dihydroindol-2-one (PubChem CID 43201943) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is 3-(4-chloro-2-methylanilino)-5-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-(4-chloro-2-methylanilino)-5-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43201943 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 3-(4-chloro-2-methylanilino)-5-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc2c(c1)C(Nc1ccc(Cl)cc1C)C(=O)N2 |
| InChI | InChI=1S/C16H15ClN2O/c1-9-3-5-14-12(7-9)15(16(20)19-14)18-13-6-4-11(17)8-10(13)2/h3-8,15,18H,1-2H3,(H,19,20) |
| InChIKey | JUQDMPDCLPQIHA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |