C17H18N2O3 — CID 43823453
3-(2,4-dimethoxyanilino)-5-methyl-1,3-dihydroindol-2-one (PubChem CID 43823453) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-(2,4-dimethoxyanilino)-5-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-(2,4-dimethoxyanilino)-5-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43823453 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(2,4-dimethoxyanilino)-5-methyl-1,3-dihydroindol-2-one |
| SMILES | COc1ccc(NC2C(=O)Nc3ccc(C)cc32)c(OC)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-10-4-6-13-12(8-10)16(17(20)19-13)18-14-7-5-11(21-2)9-15(14)22-3/h4-9,16,18H,1-3H3,(H,19,20) |
| InChIKey | HGCOLRUWUMZLKO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|