C14H20N2O2 — CID 114990088
5-methoxy-3-(pentylamino)-1,3-dihydroindol-2-one (PubChem CID 114990088) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 5-methoxy-3-(pentylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-methoxy-3-(pentylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 114990088 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 5-methoxy-3-(pentylamino)-1,3-dihydroindol-2-one |
| SMILES | CCCCCNC1C(=O)Nc2ccc(OC)cc21 |
| InChI | InChI=1S/C14H20N2O2/c1-3-4-5-8-15-13-11-9-10(18-2)6-7-12(11)16-14(13)17/h6-7,9,13,15H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | CDPATRCHHHRJBX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|