C11H14N2O2 — CID 105458950
4-ethyl-6-methoxy-3,4-dihydro-1H-quinazolin-2-one (PubChem CID 105458950) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-ethyl-6-methoxy-3,4-dihydro-1H-quinazolin-2-one.
| Compound Name | 4-ethyl-6-methoxy-3,4-dihydro-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 105458950 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-ethyl-6-methoxy-3,4-dihydro-1H-quinazolin-2-one |
| SMILES | CCC1NC(=O)Nc2ccc(OC)cc21 |
| InChI | InChI=1S/C11H14N2O2/c1-3-9-8-6-7(15-2)4-5-10(8)13-11(14)12-9/h4-6,9H,3H2,1-2H3,(H2,12,13,14) |
| InChIKey | YZKWSJSPVWRSRE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |