C11H13NO3 — CID 13260479
4-ethyl-6-methoxy-1,4-dihydro-3,1-benzoxazin-2-one (PubChem CID 13260479) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-ethyl-6-methoxy-1,4-dihydro-3,1-benzoxazin-2-one.
| Compound Name | 4-ethyl-6-methoxy-1,4-dihydro-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 13260479 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-ethyl-6-methoxy-1,4-dihydro-3,1-benzoxazin-2-one |
| SMILES | CCC1OC(=O)Nc2ccc(OC)cc21 |
| InChI | InChI=1S/C11H13NO3/c1-3-10-8-6-7(14-2)4-5-9(8)12-11(13)15-10/h4-6,10H,3H2,1-2H3,(H,12,13) |
| InChIKey | LSBLIVZXECWMJK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |