C12H14O2 — CID 14640419
1-ethyl-5-methoxy-1,3-dihydroinden-2-one (PubChem CID 14640419) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-ethyl-5-methoxy-1,3-dihydroinden-2-one.
| Compound Name | 1-ethyl-5-methoxy-1,3-dihydroinden-2-one |
|---|---|
| PubChem CID | 14640419 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-ethyl-5-methoxy-1,3-dihydroinden-2-one |
| SMILES | CCC1C(=O)Cc2cc(OC)ccc21 |
| InChI | InChI=1S/C12H14O2/c1-3-10-11-5-4-9(14-2)6-8(11)7-12(10)13/h4-6,10H,3,7H2,1-2H3 |
| InChIKey | RJSAUPWSXYNPAA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |