C16H18BrNO — CID 25139016
(3-methoxy-9,10-dihydroanthracen-9-yl)methanamine;hydrobromide (PubChem CID 25139016) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is (3-methoxy-9,10-dihydroanthracen-9-yl)methanamine;hydrobromide.
| Compound Name | (3-methoxy-9,10-dihydroanthracen-9-yl)methanamine;hydrobromide |
|---|---|
| PubChem CID | 25139016 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | (3-methoxy-9,10-dihydroanthracen-9-yl)methanamine;hydrobromide |
| SMILES | Br.COc1ccc2c(c1)Cc1ccccc1C2CN |
| InChI | InChI=1S/C16H17NO.BrH/c1-18-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)16(15)10-17;/h2-7,9,16H,8,10,17H2,1H3;1H |
| InChIKey | AZTUFAWNYOHLIA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |