C19H19FO3 — CID 83985242
3-(6-fluoro-13-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)propanoic acid (PubChem CID 83985242) has the molecular formula C19H19FO3 and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-(6-fluoro-13-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)propanoic acid.
| Compound Name | 3-(6-fluoro-13-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)propanoic acid |
|---|---|
| PubChem CID | 83985242 |
| Molecular Formula | C19H19FO3 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(6-fluoro-13-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)propanoic acid |
| SMILES | COc1ccc2c(c1)CCc1cc(F)ccc1C2CCC(=O)O |
| InChI | InChI=1S/C19H19FO3/c1-23-15-5-7-17-13(11-15)3-2-12-10-14(20)4-6-16(12)18(17)8-9-19(21)22/h4-7,10-11,18H,2-3,8-9H2,1H3,(H,21,22) |
| InChIKey | PZWPOPJJIMPRMI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |