C19H21F2N — CID 83985427
3-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-N-methylpropan-1-amine (PubChem CID 83985427) has the molecular formula C19H21F2N and a molecular weight of 301.38 g/mol. Its IUPAC name is 3-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-N-methylpropan-1-amine.
| Compound Name | 3-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 83985427 |
| Molecular Formula | C19H21F2N |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 3-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1c2ccc(F)cc2CCc2cc(F)ccc21 |
| InChI | InChI=1S/C19H21F2N/c1-22-10-2-3-19-17-8-6-15(20)11-13(17)4-5-14-12-16(21)7-9-18(14)19/h6-9,11-12,19,22H,2-5,10H2,1H3 |
| InChIKey | SYWYGWAYJSYNCW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|