C18H19F2N — CID 83985198
2-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-methylethanamine (PubChem CID 83985198) has the molecular formula C18H19F2N and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-methylethanamine.
| Compound Name | 2-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 83985198 |
| Molecular Formula | C18H19F2N |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N-methylethanamine |
| SMILES | CNCCC1c2ccccc2CCc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C18H19F2N/c1-21-9-8-15-14-5-3-2-4-12(14)6-7-13-10-17(19)18(20)11-16(13)15/h2-5,10-11,15,21H,6-9H2,1H3 |
| InChIKey | ACXFTUOTOPGBPB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |