C19H22ClN — CID 163931626
3-(7-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N-methylpropan-1-amine (PubChem CID 163931626) has the molecular formula C19H22ClN and a molecular weight of 299.84 g/mol. Its IUPAC name is 3-(7-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N-methylpropan-1-amine.
| Compound Name | 3-(7-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 163931626 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-(7-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1c2ccccc2CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C19H22ClN/c1-21-13-5-9-16-15-7-3-2-6-14(15)11-12-18-17(16)8-4-10-19(18)20/h2-4,6-8,10,16,21H,5,9,11-13H2,1H3 |
| InChIKey | ZTTQRTOLXAKEBS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|