C19H18F2O — CID 83985204
4-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)butan-2-one (PubChem CID 83985204) has the molecular formula C19H18F2O and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)butan-2-one.
| Compound Name | 4-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)butan-2-one |
|---|---|
| PubChem CID | 83985204 |
| Molecular Formula | C19H18F2O |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)butan-2-one |
| SMILES | CC(=O)CCC1c2ccccc2CCc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C19H18F2O/c1-12(22)6-9-16-15-5-3-2-4-13(15)7-8-14-10-18(20)19(21)11-17(14)16/h2-5,10-11,16H,6-9H2,1H3 |
| InChIKey | XFADLEKHMOTHTD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |