C17H17FN2O — CID 43672603
N-[3-(2,3-dihydro-1H-inden-1-ylamino)-4-fluorophenyl]acetamide (PubChem CID 43672603) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1H-inden-1-ylamino)-4-fluorophenyl]acetamide.
| Compound Name | N-[3-(2,3-dihydro-1H-inden-1-ylamino)-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 43672603 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-[3-(2,3-dihydro-1H-inden-1-ylamino)-4-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC2CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H17FN2O/c1-11(21)19-13-7-8-15(18)17(10-13)20-16-9-6-12-4-2-3-5-14(12)16/h2-5,7-8,10,16,20H,6,9H2,1H3,(H,19,21) |
| InChIKey | UXMLVKJGRPVLHP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |