C17H16FNO2 — CID 115485174
2-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzoic acid (PubChem CID 115485174) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzoic acid.
| Compound Name | 2-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzoic acid |
|---|---|
| PubChem CID | 115485174 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC2CCCc3ccccc32)cc1F |
| InChI | InChI=1S/C17H16FNO2/c18-15-10-12(8-9-14(15)17(20)21)19-16-7-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,8-10,16,19H,3,5,7H2,(H,20,21) |
| InChIKey | DODDWQAVUCQXGK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |