C15H13BrClN — CID 81263302
N-(2-bromo-4-chlorophenyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 81263302) has the molecular formula C15H13BrClN and a molecular weight of 322.63 g/mol. Its IUPAC name is N-(2-bromo-4-chlorophenyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(2-bromo-4-chlorophenyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 81263302 |
| Molecular Formula | C15H13BrClN |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | N-(2-bromo-4-chlorophenyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | Clc1ccc(NC2CCc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C15H13BrClN/c16-13-9-11(17)6-8-15(13)18-14-7-5-10-3-1-2-4-12(10)14/h1-4,6,8-9,14,18H,5,7H2 |
| InChIKey | BHTCSWSDZDVTSC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |