C15H15ClN2O2S — CID 43745883
4-chloro-3-(2,3-dihydro-1H-inden-1-ylamino)benzenesulfonamide (PubChem CID 43745883) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 4-chloro-3-(2,3-dihydro-1H-inden-1-ylamino)benzenesulfonamide.
| Compound Name | 4-chloro-3-(2,3-dihydro-1H-inden-1-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43745883 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-chloro-3-(2,3-dihydro-1H-inden-1-ylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NC2CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H15ClN2O2S/c16-13-7-6-11(21(17,19)20)9-15(13)18-14-8-5-10-3-1-2-4-12(10)14/h1-4,6-7,9,14,18H,5,8H2,(H2,17,19,20) |
| InChIKey | DRGKTPLRCUKREW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |