C11H15ClN2O4S2 — CID 43745911
4-chloro-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide (PubChem CID 43745911) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 4-chloro-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-chloro-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 43745911 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-chloro-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C11H15ClN2O4S2/c12-10-2-1-9(20(13,17)18)7-11(10)14-8-3-5-19(15,16)6-4-8/h1-2,7-8,14H,3-6H2,(H2,13,17,18) |
| InChIKey | RWOYAHJDNMHUPA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |