C11H17N3O4S2 — CID 82907239
4-amino-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide (PubChem CID 82907239) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-amino-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-amino-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 82907239 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-amino-3-[(1,1-dioxothian-4-yl)amino]benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H17N3O4S2/c12-10-2-1-9(20(13,17)18)7-11(10)14-8-3-5-19(15,16)6-4-8/h1-2,7-8,14H,3-6,12H2,(H2,13,17,18) |
| InChIKey | AWKBILMLIVKPFE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|