C11H17N3O2S — CID 82907020
4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzenesulfonamide (PubChem CID 82907020) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzenesulfonamide.
| Compound Name | 4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 82907020 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzenesulfonamide |
| SMILES | CC1(C)CC1Nc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C11H17N3O2S/c1-11(2)6-10(11)14-9-5-7(17(13,15)16)3-4-8(9)12/h3-5,10,14H,6,12H2,1-2H3,(H2,13,15,16) |
| InChIKey | VGFZCIJHTGMXGR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|