C12H17N3O — CID 63356653
4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzamide (PubChem CID 63356653) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzamide.
| Compound Name | 4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzamide |
|---|---|
| PubChem CID | 63356653 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-amino-3-[(2,2-dimethylcyclopropyl)amino]benzamide |
| SMILES | CC1(C)CC1Nc1cc(C(N)=O)ccc1N |
| InChI | InChI=1S/C12H17N3O/c1-12(2)6-10(12)15-9-5-7(11(14)16)3-4-8(9)13/h3-5,10,15H,6,13H2,1-2H3,(H2,14,16) |
| InChIKey | BNLXNRSKKHSAEY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|