C13H19BrN2O2S2 — CID 79948013
3-bromo-4-[(4,4-dimethylthian-3-yl)amino]benzenesulfonamide (PubChem CID 79948013) has the molecular formula C13H19BrN2O2S2 and a molecular weight of 379.35 g/mol. Its IUPAC name is 3-bromo-4-[(4,4-dimethylthian-3-yl)amino]benzenesulfonamide.
| Compound Name | 3-bromo-4-[(4,4-dimethylthian-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79948013 |
| Molecular Formula | C13H19BrN2O2S2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 3-bromo-4-[(4,4-dimethylthian-3-yl)amino]benzenesulfonamide |
| SMILES | CC1(C)CCSCC1Nc1ccc(S(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C13H19BrN2O2S2/c1-13(2)5-6-19-8-12(13)16-11-4-3-9(7-10(11)14)20(15,17)18/h3-4,7,12,16H,5-6,8H2,1-2H3,(H2,15,17,18) |
| InChIKey | ZAFNEECIQQOOKS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |