C14H18N2O4S — CID 79954651
N-(4,4-dimethylthian-3-yl)-6-nitro-1,3-benzodioxol-5-amine (PubChem CID 79954651) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(4,4-dimethylthian-3-yl)-6-nitro-1,3-benzodioxol-5-amine.
| Compound Name | N-(4,4-dimethylthian-3-yl)-6-nitro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 79954651 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(4,4-dimethylthian-3-yl)-6-nitro-1,3-benzodioxol-5-amine |
| SMILES | CC1(C)CCSCC1Nc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C14H18N2O4S/c1-14(2)3-4-21-7-13(14)15-9-5-11-12(20-8-19-11)6-10(9)16(17)18/h5-6,13,15H,3-4,7-8H2,1-2H3 |
| InChIKey | XTVJTRURDFKCAX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|