C11H10N2O5 — CID 64592217
N-(6-nitro-1,3-benzodioxol-5-yl)cyclopropanecarboxamide (PubChem CID 64592217) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzodioxol-5-yl)cyclopropanecarboxamide.
| Compound Name | N-(6-nitro-1,3-benzodioxol-5-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 64592217 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-(6-nitro-1,3-benzodioxol-5-yl)cyclopropanecarboxamide |
| SMILES | O=C(Nc1cc2c(cc1[N+](=O)[O-])OCO2)C1CC1 |
| InChI | InChI=1S/C11H10N2O5/c14-11(6-1-2-6)12-7-3-9-10(18-5-17-9)4-8(7)13(15)16/h3-4,6H,1-2,5H2,(H,12,14) |
| InChIKey | HAZPTAXSEGAQNM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|