C12H13ClN2O5 — CID 43697753
5-chloro-N-(6-nitro-1,3-benzodioxol-5-yl)pentanamide (PubChem CID 43697753) has the molecular formula C12H13ClN2O5 and a molecular weight of 300.70 g/mol. Its IUPAC name is 5-chloro-N-(6-nitro-1,3-benzodioxol-5-yl)pentanamide.
| Compound Name | 5-chloro-N-(6-nitro-1,3-benzodioxol-5-yl)pentanamide |
|---|---|
| PubChem CID | 43697753 |
| Molecular Formula | C12H13ClN2O5 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 5-chloro-N-(6-nitro-1,3-benzodioxol-5-yl)pentanamide |
| SMILES | O=C(CCCCCl)Nc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C12H13ClN2O5/c13-4-2-1-3-12(16)14-8-5-10-11(20-7-19-10)6-9(8)15(17)18/h5-6H,1-4,7H2,(H,14,16) |
| InChIKey | HICSNLQTBHNSTM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|