About 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide
3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide (PubChem CID 79948443) has the molecular formula C14H22N2O2S2
and a molecular weight of 314.48 g/mol. Its IUPAC name is 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide |
| PubChem CID | 79948443 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(NC2CSCCC2(C)C)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H22N2O2S2/c1-10-11(5-4-6-12(10)20(15,17)18)16-13-9-19-8-7-14(13,2)3/h4-6,13,16H,7-9H2,1-3H3,(H2,15,17,18) |
| InChIKey | QLUQBCDNJHQYSH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide?
The IUPAC name of 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide (CID 79948443) is 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide.
What is the SMILES notation for 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide?
The canonical SMILES for 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide is Cc1c(NC2CSCCC2(C)C)cccc1S(N)(=O)=O.
What is the InChIKey of 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide?
The InChIKey is QLUQBCDNJHQYSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2S2/c1-10-11(5-4-6-12(10)20(15,17)18)16-13-9-19-8-7-14(13,2)3/h4-6,13,16H,7-9H2,1-3H3,(H2,15,17,18).
What are the key properties of 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide?
3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide has a molecular weight of 314.48 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-dimethylthian-3-yl)amino]-2-methylbenzenesulfonamide is sourced from PubChem (CID 79948443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).