C12H18N2O2S2 — CID 79949483
2-methyl-3-[(5-methylthiolan-3-yl)amino]benzenesulfonamide (PubChem CID 79949483) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-methyl-3-[(5-methylthiolan-3-yl)amino]benzenesulfonamide.
| Compound Name | 2-methyl-3-[(5-methylthiolan-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79949483 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-methyl-3-[(5-methylthiolan-3-yl)amino]benzenesulfonamide |
| SMILES | Cc1c(NC2CSC(C)C2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H18N2O2S2/c1-8-6-10(7-17-8)14-11-4-3-5-12(9(11)2)18(13,15)16/h3-5,8,10,14H,6-7H2,1-2H3,(H2,13,15,16) |
| InChIKey | LSYVTEOGCJCHMW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |