C16H26N2O2S — CID 81303161
2-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]benzenesulfonamide (PubChem CID 81303161) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 2-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]benzenesulfonamide.
| Compound Name | 2-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 81303161 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]benzenesulfonamide |
| SMILES | Cc1c(NC2CCC(C)(C)CC2C)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C16H26N2O2S/c1-11-10-16(3,4)9-8-13(11)18-14-6-5-7-15(12(14)2)21(17,19)20/h5-7,11,13,18H,8-10H2,1-4H3,(H2,17,19,20) |
| InChIKey | WMHISGZRNCXZCJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |