C16H25NO2S — CID 106662154
2-ethylsulfonyl-N-(2,4,4-trimethylcyclopentyl)aniline (PubChem CID 106662154) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(2,4,4-trimethylcyclopentyl)aniline.
| Compound Name | 2-ethylsulfonyl-N-(2,4,4-trimethylcyclopentyl)aniline |
|---|---|
| PubChem CID | 106662154 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-ethylsulfonyl-N-(2,4,4-trimethylcyclopentyl)aniline |
| SMILES | CCS(=O)(=O)c1ccccc1NC1CC(C)(C)CC1C |
| InChI | InChI=1S/C16H25NO2S/c1-5-20(18,19)15-9-7-6-8-13(15)17-14-11-16(3,4)10-12(14)2/h6-9,12,14,17H,5,10-11H2,1-4H3 |
| InChIKey | ZRZYIZJHSDQNQH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |