C15H23NO3S — CID 100666033
2-[(1S,2R)-2-(2-ethylsulfonylanilino)cyclopentyl]ethanol (PubChem CID 100666033) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-[(1S,2R)-2-(2-ethylsulfonylanilino)cyclopentyl]ethanol.
| Compound Name | 2-[(1S,2R)-2-(2-ethylsulfonylanilino)cyclopentyl]ethanol |
|---|---|
| PubChem CID | 100666033 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[(1S,2R)-2-(2-ethylsulfonylanilino)cyclopentyl]ethanol |
| SMILES | CCS(=O)(=O)c1ccccc1N[C@@H]1CCC[C@H]1CCO |
| InChI | InChI=1S/C15H23NO3S/c1-2-20(18,19)15-9-4-3-7-14(15)16-13-8-5-6-12(13)10-11-17/h3-4,7,9,12-13,16-17H,2,5-6,8,10-11H2,1H3/t12-,13+/m0/s1 |
| InChIKey | WKYMCRGXBOHPJB-QWHCGFSZSA-N |
| XLogP | 2.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |