C13H20N2O3S — CID 43598929
(4S)-N-(2-ethylsulfonylphenyl)-4-methoxypyrrolidin-3-amine (PubChem CID 43598929) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is (4S)-N-(2-ethylsulfonylphenyl)-4-methoxypyrrolidin-3-amine.
| Compound Name | (4S)-N-(2-ethylsulfonylphenyl)-4-methoxypyrrolidin-3-amine |
|---|---|
| PubChem CID | 43598929 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (4S)-N-(2-ethylsulfonylphenyl)-4-methoxypyrrolidin-3-amine |
| SMILES | CCS(=O)(=O)c1ccccc1NC1CNC[C@@H]1OC |
| InChI | InChI=1S/C13H20N2O3S/c1-3-19(16,17)13-7-5-4-6-10(13)15-11-8-14-9-12(11)18-2/h4-7,11-12,14-15H,3,8-9H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | FWIDHXSDHHBLNU-KIYNQFGBSA-N |
| XLogP | 0.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |