About 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline
2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline (PubChem CID 81320855) has the molecular formula C16H24FN
and a molecular weight of 249.37 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline.
Molecular Properties
| Compound Name | 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline |
| PubChem CID | 81320855 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline |
| SMILES | Cc1ccc(F)c(NC2CCC(C)(C)CC2C)c1 |
| InChI | InChI=1S/C16H24FN/c1-11-5-6-13(17)15(9-11)18-14-7-8-16(3,4)10-12(14)2/h5-6,9,12,14,18H,7-8,10H2,1-4H3 |
| InChIKey | XRIMDGRSXJXYRR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline?
The IUPAC name of 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline (CID 81320855) is 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline.
What is the SMILES notation for 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline?
The canonical SMILES for 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline is Cc1ccc(F)c(NC2CCC(C)(C)CC2C)c1.
What is the InChIKey of 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline?
The InChIKey is XRIMDGRSXJXYRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24FN/c1-11-5-6-13(17)15(9-11)18-14-7-8-16(3,4)10-12(14)2/h5-6,9,12,14,18H,7-8,10H2,1-4H3.
What are the key properties of 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline?
2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline has a molecular weight of 249.37 g/mol, XLogP of 4.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-methyl-N-(2,4,4-trimethylcyclohexyl)aniline is sourced from PubChem (CID 81320855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).