C14H20N2OS — CID 79952112
3-[(4,4-dimethylthian-3-yl)amino]benzamide (PubChem CID 79952112) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 3-[(4,4-dimethylthian-3-yl)amino]benzamide.
| Compound Name | 3-[(4,4-dimethylthian-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 79952112 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[(4,4-dimethylthian-3-yl)amino]benzamide |
| SMILES | CC1(C)CCSCC1Nc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C14H20N2OS/c1-14(2)6-7-18-9-12(14)16-11-5-3-4-10(8-11)13(15)17/h3-5,8,12,16H,6-7,9H2,1-2H3,(H2,15,17) |
| InChIKey | IDRDSNYJJKFTHQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |