C15H20N2S2 — CID 79948338
N-(4,4-dimethylthian-3-yl)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 79948338) has the molecular formula C15H20N2S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is N-(4,4-dimethylthian-3-yl)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | N-(4,4-dimethylthian-3-yl)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 79948338 |
| Molecular Formula | C15H20N2S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-(4,4-dimethylthian-3-yl)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2ccc(NC3CSCCC3(C)C)cc2s1 |
| InChI | InChI=1S/C15H20N2S2/c1-10-16-12-5-4-11(8-13(12)19-10)17-14-9-18-7-6-15(14,2)3/h4-5,8,14,17H,6-7,9H2,1-3H3 |
| InChIKey | XTQYUZSWVCGAIM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |