C17H24N2S — CID 65084135
N-(4-ethylcycloheptyl)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 65084135) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is N-(4-ethylcycloheptyl)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | N-(4-ethylcycloheptyl)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 65084135 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-(4-ethylcycloheptyl)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | CCC1CCCC(Nc2ccc3nc(C)sc3c2)CC1 |
| InChI | InChI=1S/C17H24N2S/c1-3-13-5-4-6-14(8-7-13)19-15-9-10-16-17(11-15)20-12(2)18-16/h9-11,13-14,19H,3-8H2,1-2H3 |
| InChIKey | XOKANRIOZUMDOC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |