C16H22N2S — CID 64751144
N-(3,5-dimethylcyclohexyl)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 64751144) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 64751144 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2ccc(NC3CC(C)CC(C)C3)cc2s1 |
| InChI | InChI=1S/C16H22N2S/c1-10-6-11(2)8-14(7-10)18-13-4-5-15-16(9-13)19-12(3)17-15/h4-5,9-11,14,18H,6-8H2,1-3H3 |
| InChIKey | KXWOKXLHIWHKRQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |