C8H7N2O2S2- — CID 20746267
2-methyl-6-(sulfinatoamino)-1,3-benzothiazole (PubChem CID 20746267) has the molecular formula C8H7N2O2S2- and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-methyl-6-(sulfinatoamino)-1,3-benzothiazole.
| Compound Name | 2-methyl-6-(sulfinatoamino)-1,3-benzothiazole |
|---|---|
| PubChem CID | 20746267 |
| Molecular Formula | C8H7N2O2S2- |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 2-methyl-6-(sulfinatoamino)-1,3-benzothiazole |
| SMILES | Cc1nc2ccc(NS(=O)[O-])cc2s1 |
| InChI | InChI=1S/C8H8N2O2S2/c1-5-9-7-3-2-6(10-14(11)12)4-8(7)13-5/h2-4,10H,1H3,(H,11,12)/p-1 |
| InChIKey | JDNNWSWSCYHYNB-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|