C11H15N3S — CID 103388112
2-N-(2-methyl-1,3-benzothiazol-6-yl)propane-1,2-diamine (PubChem CID 103388112) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-N-(2-methyl-1,3-benzothiazol-6-yl)propane-1,2-diamine.
| Compound Name | 2-N-(2-methyl-1,3-benzothiazol-6-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 103388112 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-N-(2-methyl-1,3-benzothiazol-6-yl)propane-1,2-diamine |
| SMILES | Cc1nc2ccc(NC(C)CN)cc2s1 |
| InChI | InChI=1S/C11H15N3S/c1-7(6-12)13-9-3-4-10-11(5-9)15-8(2)14-10/h3-5,7,13H,6,12H2,1-2H3 |
| InChIKey | OYCIBYJKARKKIP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |