C14H14N2OS — CID 43682683
N-[1-(furan-2-yl)ethyl]-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 43682683) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | N-[1-(furan-2-yl)ethyl]-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 43682683 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2ccc(NC(C)c3ccco3)cc2s1 |
| InChI | InChI=1S/C14H14N2OS/c1-9(13-4-3-7-17-13)15-11-5-6-12-14(8-11)18-10(2)16-12/h3-9,15H,1-2H3 |
| InChIKey | YKSGMNZZBMWJIW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |