C14H18N2S — CID 104655447
N-hex-5-en-2-yl-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 104655447) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-hex-5-en-2-yl-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | N-hex-5-en-2-yl-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 104655447 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-hex-5-en-2-yl-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | C=CCCC(C)Nc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C14H18N2S/c1-4-5-6-10(2)15-12-7-8-13-14(9-12)17-11(3)16-13/h4,7-10,15H,1,5-6H2,2-3H3 |
| InChIKey | XDMPGNILEUWRCK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|