C10H12N4S — CID 19154623
N-(ethyldiazenyl)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 19154623) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is N-(ethyldiazenyl)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | N-(ethyldiazenyl)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 19154623 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-(ethyldiazenyl)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | CC/N=N/Nc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C10H12N4S/c1-3-11-14-13-8-4-5-9-10(6-8)15-7(2)12-9/h4-6H,3H2,1-2H3,(H,11,13) |
| InChIKey | ZIKPJWCXJQBUGM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|