C17H15N3S — CID 102909567
N-(1H-indol-5-ylmethyl)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 102909567) has the molecular formula C17H15N3S and a molecular weight of 293.40 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | N-(1H-indol-5-ylmethyl)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 102909567 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2ccc(NCc3ccc4[nH]ccc4c3)cc2s1 |
| InChI | InChI=1S/C17H15N3S/c1-11-20-16-5-3-14(9-17(16)21-11)19-10-12-2-4-15-13(8-12)6-7-18-15/h2-9,18-19H,10H2,1H3 |
| InChIKey | UVWZGTUQFLZQFB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |