C9H11NO2S2 — CID 169128433
2-methyl-6-methylsulfinyl-1,3-benzothiazole;hydrate (PubChem CID 169128433) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-methyl-6-methylsulfinyl-1,3-benzothiazole;hydrate.
| Compound Name | 2-methyl-6-methylsulfinyl-1,3-benzothiazole;hydrate |
|---|---|
| PubChem CID | 169128433 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-methyl-6-methylsulfinyl-1,3-benzothiazole;hydrate |
| SMILES | Cc1nc2ccc(S(C)=O)cc2s1.O |
| InChI | InChI=1S/C9H9NOS2.H2O/c1-6-10-8-4-3-7(13(2)11)5-9(8)12-6;/h3-5H,1-2H3;1H2 |
| InChIKey | CYIQSMPIQNVXIH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 61.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |