C9H6N2S2 — CID 15147661
(2-methyl-1,3-benzothiazol-6-yl) thiocyanate (PubChem CID 15147661) has the molecular formula C9H6N2S2 and a molecular weight of 206.30 g/mol. Its IUPAC name is (2-methyl-1,3-benzothiazol-6-yl) thiocyanate.
| Compound Name | (2-methyl-1,3-benzothiazol-6-yl) thiocyanate |
|---|---|
| PubChem CID | 15147661 |
| Molecular Formula | C9H6N2S2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | (2-methyl-1,3-benzothiazol-6-yl) thiocyanate |
| SMILES | Cc1nc2ccc(SC#N)cc2s1 |
| InChI | InChI=1S/C9H6N2S2/c1-6-11-8-3-2-7(12-5-10)4-9(8)13-6/h2-4H,1H3 |
| InChIKey | LODDEJZLBCPBIQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|