C15H16N4O3S2 — CID 87432094
2-morpholin-4-ylethyl-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamic acid (PubChem CID 87432094) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamic acid.
| Compound Name | 2-morpholin-4-ylethyl-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 87432094 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-morpholin-4-ylethyl-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamic acid |
| SMILES | N#CSc1ccc2nc(N(CCN3CCOCC3)C(=O)O)sc2c1 |
| InChI | InChI=1S/C15H16N4O3S2/c16-10-23-11-1-2-12-13(9-11)24-14(17-12)19(15(20)21)4-3-18-5-7-22-8-6-18/h1-2,9H,3-8H2,(H,20,21) |
| InChIKey | FSNKNOPHQLIJCS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|