C14H17N3O3S2 — CID 68629695
2-morpholin-4-ylethyl-(6-sulfanyl-1,3-benzothiazol-2-yl)carbamic acid (PubChem CID 68629695) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl-(6-sulfanyl-1,3-benzothiazol-2-yl)carbamic acid.
| Compound Name | 2-morpholin-4-ylethyl-(6-sulfanyl-1,3-benzothiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 68629695 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-morpholin-4-ylethyl-(6-sulfanyl-1,3-benzothiazol-2-yl)carbamic acid |
| SMILES | O=C(O)N(CCN1CCOCC1)c1nc2ccc(S)cc2s1 |
| InChI | InChI=1S/C14H17N3O3S2/c18-14(19)17(4-3-16-5-7-20-8-6-16)13-15-11-2-1-10(21)9-12(11)22-13/h1-2,9,21H,3-8H2,(H,18,19) |
| InChIKey | WVDZKNDMINAKED-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|