C13H12N3O2S2- — CID 86647888
N-tert-butyl-N-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamate (PubChem CID 86647888) has the molecular formula C13H12N3O2S2- and a molecular weight of 306.39 g/mol. Its IUPAC name is N-tert-butyl-N-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | N-tert-butyl-N-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 86647888 |
| Molecular Formula | C13H12N3O2S2- |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-tert-butyl-N-(6-thiocyanato-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CC(C)(C)N(C(=O)[O-])c1nc2ccc(SC#N)cc2s1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-13(2,3)16(12(17)18)11-15-9-5-4-8(19-7-14)6-10(9)20-11/h4-6H,1-3H3,(H,17,18)/p-1 |
| InChIKey | LGDPDUJJHRJDCJ-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|