C10H9N3S — CID 45077325
methyl-(6-methyl-1,3-benzothiazol-2-yl)cyanamide (PubChem CID 45077325) has the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. Its IUPAC name is methyl-(6-methyl-1,3-benzothiazol-2-yl)cyanamide.
| Compound Name | methyl-(6-methyl-1,3-benzothiazol-2-yl)cyanamide |
|---|---|
| PubChem CID | 45077325 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | methyl-(6-methyl-1,3-benzothiazol-2-yl)cyanamide |
| SMILES | Cc1ccc2nc(N(C)C#N)sc2c1 |
| InChI | InChI=1S/C10H9N3S/c1-7-3-4-8-9(5-7)14-10(12-8)13(2)6-11/h3-5H,1-2H3 |
| InChIKey | LNZQEQBWMWIFOC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|