C10H12N2OS — CID 45077125
N-ethyl-N-(6-methyl-1,3-benzothiazol-2-yl)hydroxylamine (PubChem CID 45077125) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is N-ethyl-N-(6-methyl-1,3-benzothiazol-2-yl)hydroxylamine.
| Compound Name | N-ethyl-N-(6-methyl-1,3-benzothiazol-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 45077125 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N-ethyl-N-(6-methyl-1,3-benzothiazol-2-yl)hydroxylamine |
| SMILES | CCN(O)c1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C10H12N2OS/c1-3-12(13)10-11-8-5-4-7(2)6-9(8)14-10/h4-6,13H,3H2,1-2H3 |
| InChIKey | JIATXCPRQRROFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|