C8H6FNS — CID 23270279
2-fluoro-6-methyl-1,3-benzothiazole (PubChem CID 23270279) has the molecular formula C8H6FNS and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-fluoro-6-methyl-1,3-benzothiazole.
| Compound Name | 2-fluoro-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 23270279 |
| Molecular Formula | C8H6FNS |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 2-fluoro-6-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(F)sc2c1 |
| InChI | InChI=1S/C8H6FNS/c1-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3 |
| InChIKey | TXVVFXGDVSZTRI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |