C14H10FIN2S — CID 79766011
N-(4-fluoro-2-iodophenyl)-6-methyl-1,3-benzothiazol-2-amine (PubChem CID 79766011) has the molecular formula C14H10FIN2S and a molecular weight of 384.22 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-6-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(4-fluoro-2-iodophenyl)-6-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79766011 |
| Molecular Formula | C14H10FIN2S |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-6-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2nc(Nc3ccc(F)cc3I)sc2c1 |
| InChI | InChI=1S/C14H10FIN2S/c1-8-2-4-12-13(6-8)19-14(18-12)17-11-5-3-9(15)7-10(11)16/h2-7H,1H3,(H,17,18) |
| InChIKey | MEVSTUPIFSOCRZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|